About 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one
3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one (PubChem CID 13381148) has the molecular formula C13H11ClN4O
and a molecular weight of 274.71 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one |
| PubChem CID | 13381148 |
| Molecular Formula | C13H11ClN4O |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one |
| SMILES | Cn1ncc2c(c(-c3ccc(Cl)cc3)nn2C)c1=O |
| InChI | InChI=1S/C13H11ClN4O/c1-17-10-7-15-18(2)13(19)11(10)12(16-17)8-3-5-9(14)6-4-8/h3-7H,1-2H3 |
| InChIKey | YJOXNFLXQZKVSX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one?
The IUPAC name of 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one (CID 13381148) is 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one.
What is the SMILES notation for 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one?
The canonical SMILES for 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one is Cn1ncc2c(c(-c3ccc(Cl)cc3)nn2C)c1=O.
What is the InChIKey of 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one?
The InChIKey is YJOXNFLXQZKVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN4O/c1-17-10-7-15-18(2)13(19)11(10)12(16-17)8-3-5-9(14)6-4-8/h3-7H,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one?
3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one has a molecular weight of 274.71 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1,5-dimethylpyrazolo[3,4-d]pyridazin-4-one is sourced from PubChem (CID 13381148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).