C13H20F3NO2 — CID 133817121
2-(2-bicyclo[2.2.1]heptanyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide (PubChem CID 133817121) has the molecular formula C13H20F3NO2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 133817121 |
| Molecular Formula | C13H20F3NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
| SMILES | C1CC2CC1CC2CC(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C13H20F3NO2/c14-13(15,16)8-19-4-3-17-12(18)7-11-6-9-1-2-10(11)5-9/h9-11H,1-8H2,(H,17,18) |
| InChIKey | HSEWDJYAXNVMQV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | 320 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|