About tert-butyl 3-hydroxybenzoate
tert-butyl 3-hydroxybenzoate (PubChem CID 13382081) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is tert-butyl 3-hydroxybenzoate.
Molecular Properties
| Compound Name | tert-butyl 3-hydroxybenzoate |
| PubChem CID | 13382081 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | tert-butyl 3-hydroxybenzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C11H14O3/c1-11(2,3)14-10(13)8-5-4-6-9(12)7-8/h4-7,12H,1-3H3 |
| InChIKey | XAOVNTXDHGDNBG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 3-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-hydroxybenzoate?
The IUPAC name of tert-butyl 3-hydroxybenzoate (CID 13382081) is tert-butyl 3-hydroxybenzoate.
What is the SMILES notation for tert-butyl 3-hydroxybenzoate?
The canonical SMILES for tert-butyl 3-hydroxybenzoate is CC(C)(C)OC(=O)c1cccc(O)c1.
What is the InChIKey of tert-butyl 3-hydroxybenzoate?
The InChIKey is XAOVNTXDHGDNBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-11(2,3)14-10(13)8-5-4-6-9(12)7-8/h4-7,12H,1-3H3.
What are the key properties of tert-butyl 3-hydroxybenzoate?
tert-butyl 3-hydroxybenzoate has a molecular weight of 194.23 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-hydroxybenzoate is sourced from PubChem (CID 13382081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).