C5F9NO — CID 13383161
1,1,2,2,3,3,4,4,5-nonafluoro-5-nitrosocyclopentane (PubChem CID 13383161) has the molecular formula C5F9NO and a molecular weight of 261.04 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5-nonafluoro-5-nitrosocyclopentane.
| Compound Name | 1,1,2,2,3,3,4,4,5-nonafluoro-5-nitrosocyclopentane |
|---|---|
| PubChem CID | 13383161 |
| Molecular Formula | C5F9NO |
| Molecular Weight | 261.04 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5-nonafluoro-5-nitrosocyclopentane |
| SMILES | O=NC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5F9NO/c6-1(7)2(8,9)4(12,13)5(14,15-16)3(1,10)11 |
| InChIKey | AWDVPLYXQHERRY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.04 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|