C8H3F9S — CID 13383169
2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophene (PubChem CID 13383169) has the molecular formula C8H3F9S and a molecular weight of 302.16 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophene.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophene |
|---|---|
| PubChem CID | 13383169 |
| Molecular Formula | C8H3F9S |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1cccs1 |
| InChI | InChI=1S/C8H3F9S/c9-5(10,4-2-1-3-18-4)6(11,12)7(13,14)8(15,16)17/h1-3H |
| InChIKey | KKXHYYMDJMMUQM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|