C37H67O12P — CID 13383667
2-[(4-decyl-2-diethoxyphosphorylphenoxy)methyl]-1,4,7,10,13,16,19,22-octaoxacyclotetracosane (PubChem CID 13383667) has the molecular formula C37H67O12P and a molecular weight of 734.90 g/mol. Its IUPAC name is 2-[(4-decyl-2-diethoxyphosphorylphenoxy)methyl]-1,4,7,10,13,16,19,22-octaoxacyclotetracosane.
| Compound Name | 2-[(4-decyl-2-diethoxyphosphorylphenoxy)methyl]-1,4,7,10,13,16,19,22-octaoxacyclotetracosane |
|---|---|
| PubChem CID | 13383667 |
| Molecular Formula | C37H67O12P |
| Molecular Weight | 734.90 g/mol |
| Exact Mass | 734.44 |
| IUPAC Name | 2-[(4-decyl-2-diethoxyphosphorylphenoxy)methyl]-1,4,7,10,13,16,19,22-octaoxacyclotetracosane |
| SMILES | CCCCCCCCCCc1ccc(OCC2COCCOCCOCCOCCOCCOCCOCCO2)c(P(=O)(OCC)OCC)c1 |
| InChI | InChI=1S/C37H67O12P/c1-4-7-8-9-10-11-12-13-14-34-15-16-36(37(31-34)50(38,48-5-2)49-6-3)47-33-35-32-45-28-27-43-24-23-41-20-19-39-17-18-40-21-22-42-25-26-44-29-30-46-35/h15-16,31,35H,4-14,17-30,32-33H2,1-3H3 |
| InChIKey | BSXWFEXPMZRCFO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.90 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|