About ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate
ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate (PubChem CID 13383905) has the molecular formula C21H18N2O2
and a molecular weight of 330.39 g/mol. Its IUPAC name is ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 13383905 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c3ccccc3n(Cc3ccccc3)c2cn1 |
| InChI | InChI=1S/C21H18N2O2/c1-2-25-21(24)18-12-17-16-10-6-7-11-19(16)23(20(17)13-22-18)14-15-8-4-3-5-9-15/h3-13H,2,14H2,1H3 |
| InChIKey | XJHWMGBLNIXNHU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate (CID 13383905) is ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate is CCOC(=O)c1cc2c3ccccc3n(Cc3ccccc3)c2cn1.
What is the InChIKey of ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate?
The InChIKey is XJHWMGBLNIXNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O2/c1-2-25-21(24)18-12-17-16-10-6-7-11-19(16)23(20(17)13-22-18)14-15-8-4-3-5-9-15/h3-13H,2,14H2,1H3.
What are the key properties of ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate?
ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate has a molecular weight of 330.39 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9-benzylpyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 13383905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).