About [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol
[2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol (PubChem CID 13383981) has the molecular formula C10H20O5
and a molecular weight of 220.26 g/mol. Its IUPAC name is [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol |
| PubChem CID | 13383981 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol |
| SMILES | OCC1C(CO)C(CO)C(CO)C1CO |
| InChI | InChI=1S/C10H20O5/c11-1-6-7(2-12)9(4-14)10(5-15)8(6)3-13/h6-15H,1-5H2 |
| InChIKey | XEYDCFAOONOIQD-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol?
The IUPAC name of [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol (CID 13383981) is [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol.
What is the SMILES notation for [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol?
The canonical SMILES for [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol is OCC1C(CO)C(CO)C(CO)C1CO.
What is the InChIKey of [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol?
The InChIKey is XEYDCFAOONOIQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5/c11-1-6-7(2-12)9(4-14)10(5-15)8(6)3-13/h6-15H,1-5H2.
What are the key properties of [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol?
[2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol has a molecular weight of 220.26 g/mol, XLogP of -1.96, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3,4,5-tetrakis(hydroxymethyl)cyclopentyl]methanol is sourced from PubChem (CID 13383981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).