About 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine
1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine (PubChem CID 13384095) has the molecular formula C12H15BrN2
and a molecular weight of 267.17 g/mol. Its IUPAC name is 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine |
| PubChem CID | 13384095 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine |
| SMILES | Cc1[nH]c2cc(Br)ccc2c1CN(C)C |
| InChI | InChI=1S/C12H15BrN2/c1-8-11(7-15(2)3)10-5-4-9(13)6-12(10)14-8/h4-6,14H,7H2,1-3H3 |
| InChIKey | NFVQHSDQKOTZIK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine (CID 13384095) is 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine is Cc1[nH]c2cc(Br)ccc2c1CN(C)C.
What is the InChIKey of 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine?
The InChIKey is NFVQHSDQKOTZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN2/c1-8-11(7-15(2)3)10-5-4-9(13)6-12(10)14-8/h4-6,14H,7H2,1-3H3.
What are the key properties of 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine?
1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine has a molecular weight of 267.17 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-2-methyl-1H-indol-3-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 13384095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).