C32H40O19S — CID 13384929
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(2,5-dihydroxyphenyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 13384929) has the molecular formula C32H40O19S and a molecular weight of 760.72 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(2,5-dihydroxyphenyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(2,5-dihydroxyphenyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 13384929 |
| Molecular Formula | C32H40O19S |
| Molecular Weight | 760.72 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(2,5-dihydroxyphenyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2cc(O)ccc2O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H40O19S/c1-13(33)42-11-22-25(44-15(3)35)27(45-16(4)36)29(47-18(6)38)31(49-22)51-26-23(12-43-14(2)34)50-32(52-24-10-20(40)8-9-21(24)41)30(48-19(7)39)28(26)46-17(5)37/h8-10,22-23,25-32,40-41H,11-12H2,1-7H3/t22-,23-,25-,26-,27+,28+,29-,30-,31-,32+/m1/s1 |
| InChIKey | DDPQWYIWSFCBPD-YUIOHPEOSA-N |
| XLogP | 0.81 |
| TPSA | 252.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.72 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|