C10H9N5 — CID 13385680
N-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine (PubChem CID 13385680) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is N-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine.
| Compound Name | N-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 13385680 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | N-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| SMILES | CNc1nc2ccccc2n2cnnc12 |
| InChI | InChI=1S/C10H9N5/c1-11-9-10-14-12-6-15(10)8-5-3-2-4-7(8)13-9/h2-6H,1H3,(H,11,13) |
| InChIKey | OKMBFCGUSTURFV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |