C11H11N5 — CID 13385711
1-ethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine (PubChem CID 13385711) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is 1-ethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine.
| Compound Name | 1-ethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 13385711 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-ethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| SMILES | CCc1nnc2c(N)nc3ccccc3n12 |
| InChI | InChI=1S/C11H11N5/c1-2-9-14-15-11-10(12)13-7-5-3-4-6-8(7)16(9)11/h3-6H,2H2,1H3,(H2,12,13) |
| InChIKey | OCIBVLGWPDAOAZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |