C15H19N5 — CID 13385715
N,N,1-triethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine (PubChem CID 13385715) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is N,N,1-triethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine.
| Compound Name | N,N,1-triethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 13385715 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N,N,1-triethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| SMILES | CCc1nnc2c(N(CC)CC)nc3ccccc3n12 |
| InChI | InChI=1S/C15H19N5/c1-4-13-17-18-15-14(19(5-2)6-3)16-11-9-7-8-10-12(11)20(13)15/h7-10H,4-6H2,1-3H3 |
| InChIKey | CCYLTMPHQCIOMN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |