C11H10ClN5 — CID 13385768
7-chloro-1-ethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine (PubChem CID 13385768) has the molecular formula C11H10ClN5 and a molecular weight of 247.69 g/mol. Its IUPAC name is 7-chloro-1-ethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine.
| Compound Name | 7-chloro-1-ethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 13385768 |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 7-chloro-1-ethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| SMILES | CCc1nnc2c(N)nc3cc(Cl)ccc3n12 |
| InChI | InChI=1S/C11H10ClN5/c1-2-9-15-16-11-10(13)14-7-5-6(12)3-4-8(7)17(9)11/h3-5H,2H2,1H3,(H2,13,14) |
| InChIKey | FHKCJENTVHZIGM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |