About [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate
[2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate (PubChem CID 13386127) has the molecular formula C20H12F2N2O2
and a molecular weight of 350.32 g/mol. Its IUPAC name is [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate |
| PubChem CID | 13386127 |
| Molecular Formula | C20H12F2N2O2 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate |
| SMILES | O=C(Oc1c(-c2ccc(F)cc2)nn2ccccc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H12F2N2O2/c21-15-8-4-13(5-9-15)18-19(17-3-1-2-12-24(17)23-18)26-20(25)14-6-10-16(22)11-7-14/h1-12H |
| InChIKey | ITLNPJJFOUHNTQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate?
The IUPAC name of [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate (CID 13386127) is [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate.
What is the SMILES notation for [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate?
The canonical SMILES for [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate is O=C(Oc1c(-c2ccc(F)cc2)nn2ccccc12)c1ccc(F)cc1.
What is the InChIKey of [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate?
The InChIKey is ITLNPJJFOUHNTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F2N2O2/c21-15-8-4-13(5-9-15)18-19(17-3-1-2-12-24(17)23-18)26-20(25)14-6-10-16(22)11-7-14/h1-12H.
What are the key properties of [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate?
[2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate has a molecular weight of 350.32 g/mol, XLogP of 4.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-3-yl] 4-fluorobenzoate is sourced from PubChem (CID 13386127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).