About 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol
2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol (PubChem CID 13386212) has the molecular formula C10H20O6
and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol.
Molecular Properties
| Compound Name | 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| PubChem CID | 13386212 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCOC1(CO)OC(CO)C(O)C1O |
| InChI | InChI=1S/C10H20O6/c1-2-3-4-15-10(6-12)9(14)8(13)7(5-11)16-10/h7-9,11-14H,2-6H2,1H3 |
| InChIKey | XRGRZXPJJVQDJO-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol?
The IUPAC name of 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol (CID 13386212) is 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol.
What is the SMILES notation for 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol?
The canonical SMILES for 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol is CCCCOC1(CO)OC(CO)C(O)C1O.
What is the InChIKey of 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol?
The InChIKey is XRGRZXPJJVQDJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O6/c1-2-3-4-15-10(6-12)9(14)8(13)7(5-11)16-10/h7-9,11-14H,2-6H2,1H3.
What are the key properties of 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol?
2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol has a molecular weight of 236.26 g/mol, XLogP of -1.40, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol is sourced from PubChem (CID 13386212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).