About 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide
7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide (PubChem CID 13386708) has the molecular formula C16H11Cl2N3O2
and a molecular weight of 348.19 g/mol. Its IUPAC name is 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide.
Molecular Properties
| Compound Name | 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide |
| PubChem CID | 13386708 |
| Molecular Formula | C16H11Cl2N3O2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide |
| SMILES | NC(=O)C1N=C(c2ccccc2Cl)c2cc(Cl)ccc2NC1=O |
| InChI | InChI=1S/C16H11Cl2N3O2/c17-8-5-6-12-10(7-8)13(9-3-1-2-4-11(9)18)21-14(15(19)22)16(23)20-12/h1-7,14H,(H2,19,22)(H,20,23) |
| InChIKey | HBHDPLQRSMMSNI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide?
The IUPAC name of 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide (CID 13386708) is 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide.
What is the SMILES notation for 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide?
The canonical SMILES for 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide is NC(=O)C1N=C(c2ccccc2Cl)c2cc(Cl)ccc2NC1=O.
What is the InChIKey of 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide?
The InChIKey is HBHDPLQRSMMSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N3O2/c17-8-5-6-12-10(7-8)13(9-3-1-2-4-11(9)18)21-14(15(19)22)16(23)20-12/h1-7,14H,(H2,19,22)(H,20,23).
What are the key properties of 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide?
7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide has a molecular weight of 348.19 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxamide is sourced from PubChem (CID 13386708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).