About 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione
6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 13387154) has the molecular formula C8H14N4O2
and a molecular weight of 198.23 g/mol. Its IUPAC name is 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 13387154 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(NCCN)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C8H14N4O2/c1-11-6(10-4-3-9)5-7(13)12(2)8(11)14/h5,10H,3-4,9H2,1-2H3 |
| InChIKey | WIWKFINWESOMJF-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione (CID 13387154) is 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione is Cn1c(NCCN)cc(=O)n(C)c1=O.
What is the InChIKey of 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is WIWKFINWESOMJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2/c1-11-6(10-4-3-9)5-7(13)12(2)8(11)14/h5,10H,3-4,9H2,1-2H3.
What are the key properties of 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione?
6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 198.23 g/mol, XLogP of -1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-aminoethylamino)-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 13387154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).