About 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol
1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol (PubChem CID 13387299) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol.
Molecular Properties
| Compound Name | 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol |
| PubChem CID | 13387299 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol |
| SMILES | NCC1OCc2c1ccc(O)c2O |
| InChI | InChI=1S/C9H11NO3/c10-3-8-5-1-2-7(11)9(12)6(5)4-13-8/h1-2,8,11-12H,3-4,10H2 |
| InChIKey | WKBXDYPKIPBECR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol?
The IUPAC name of 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol (CID 13387299) is 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol.
What is the SMILES notation for 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol?
The canonical SMILES for 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol is NCC1OCc2c1ccc(O)c2O.
What is the InChIKey of 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol?
The InChIKey is WKBXDYPKIPBECR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c10-3-8-5-1-2-7(11)9(12)6(5)4-13-8/h1-2,8,11-12H,3-4,10H2.
What are the key properties of 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol?
1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol has a molecular weight of 181.19 g/mol, XLogP of 0.63, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)-1,3-dihydro-2-benzofuran-4,5-diol is sourced from PubChem (CID 13387299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).