C14H15N3O4S — CID 13387709
1-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)-3-ethylimidazolidine-2,4,5-trione (PubChem CID 13387709) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 1-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)-3-ethylimidazolidine-2,4,5-trione.
| Compound Name | 1-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)-3-ethylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 13387709 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)-3-ethylimidazolidine-2,4,5-trione |
| SMILES | CCN1C(=O)C(=O)N(c2nc3c(s2)C(=O)CC(C)(C)C3)C1=O |
| InChI | InChI=1S/C14H15N3O4S/c1-4-16-10(19)11(20)17(13(16)21)12-15-7-5-14(2,3)6-8(18)9(7)22-12/h4-6H2,1-3H3 |
| InChIKey | ZHYYVUKPSSBFMF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|