C22H13FN4O4S — CID 1338937
(5E)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 1338937) has the molecular formula C22H13FN4O4S and a molecular weight of 448.44 g/mol. Its IUPAC name is (5E)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1338937 |
| Molecular Formula | C22H13FN4O4S |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | (5E)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccccc2F)C(=O)/C1=C/c1ccc(Sc2nc3ccccc3[nH]2)o1 |
| InChI | InChI=1S/C22H13FN4O4S/c23-14-5-1-4-8-17(14)27-20(29)13(19(28)26-22(27)30)11-12-9-10-18(31-12)32-21-24-15-6-2-3-7-16(15)25-21/h1-11H,(H,24,25)(H,26,28,30)/b13-11+ |
| InChIKey | BVCGEJZBGDARKR-ACCUITESSA-N |
| XLogP | 4.11 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|