C11H13F3O4 — CID 13390084
2,2-dimethyl-3-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 13390084) has the molecular formula C11H13F3O4 and a molecular weight of 266.21 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-3-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 13390084 |
| Molecular Formula | C11H13F3O4 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2,2-dimethyl-3-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(/C=C/C(=O)OCC(F)(F)F)C1C(=O)O |
| InChI | InChI=1S/C11H13F3O4/c1-10(2)6(8(10)9(16)17)3-4-7(15)18-5-11(12,13)14/h3-4,6,8H,5H2,1-2H3,(H,16,17)/b4-3+ |
| InChIKey | DBCBNGIOEPKILU-ONEGZZNKSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|