About methyl 3-methylsulfanylpropanimidate;hydrochloride
methyl 3-methylsulfanylpropanimidate;hydrochloride (PubChem CID 13392592) has the molecular formula C5H12ClNOS
and a molecular weight of 169.68 g/mol. Its IUPAC name is methyl 3-methylsulfanylpropanimidate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-methylsulfanylpropanimidate;hydrochloride |
| PubChem CID | 13392592 |
| Molecular Formula | C5H12ClNOS |
| Molecular Weight | 169.68 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | methyl 3-methylsulfanylpropanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(/CCSC)OC |
| InChI | InChI=1S/C5H11NOS.ClH/c1-7-5(6)3-4-8-2;/h6H,3-4H2,1-2H3;1H/b6-5-; |
| InChIKey | FVFSJFUDXUSTSR-YSMBQZINSA-N |
| XLogP | 1.78 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-methylsulfanylpropanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methylsulfanylpropanimidate;hydrochloride?
The IUPAC name of methyl 3-methylsulfanylpropanimidate;hydrochloride (CID 13392592) is methyl 3-methylsulfanylpropanimidate;hydrochloride.
What is the SMILES notation for methyl 3-methylsulfanylpropanimidate;hydrochloride?
The canonical SMILES for methyl 3-methylsulfanylpropanimidate;hydrochloride is Cl.[H]/N=C(/CCSC)OC.
What is the InChIKey of methyl 3-methylsulfanylpropanimidate;hydrochloride?
The InChIKey is FVFSJFUDXUSTSR-YSMBQZINSA-N. The full InChI is InChI=1S/C5H11NOS.ClH/c1-7-5(6)3-4-8-2;/h6H,3-4H2,1-2H3;1H/b6-5-;.
What are the key properties of methyl 3-methylsulfanylpropanimidate;hydrochloride?
methyl 3-methylsulfanylpropanimidate;hydrochloride has a molecular weight of 169.68 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methylsulfanylpropanimidate;hydrochloride is sourced from PubChem (CID 13392592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).