C13H12N4O5S — CID 13392819
[3-methoxy-4-(5-oxo-3,4-dihydroimidazo[4,5-b]pyrazin-2-yl)phenyl] methanesulfonate (PubChem CID 13392819) has the molecular formula C13H12N4O5S and a molecular weight of 336.33 g/mol. Its IUPAC name is [3-methoxy-4-(5-oxo-3,4-dihydroimidazo[4,5-b]pyrazin-2-yl)phenyl] methanesulfonate.
| Compound Name | [3-methoxy-4-(5-oxo-3,4-dihydroimidazo[4,5-b]pyrazin-2-yl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 13392819 |
| Molecular Formula | C13H12N4O5S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [3-methoxy-4-(5-oxo-3,4-dihydroimidazo[4,5-b]pyrazin-2-yl)phenyl] methanesulfonate |
| SMILES | COc1cc(OS(C)(=O)=O)ccc1-c1nc2ncc(=O)[nH]c2[nH]1 |
| InChI | InChI=1S/C13H12N4O5S/c1-21-9-5-7(22-23(2,19)20)3-4-8(9)11-16-12-13(17-11)15-10(18)6-14-12/h3-6H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | SLFHMARRBXWQDO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|