About [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate
[3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate (PubChem CID 13392821) has the molecular formula C15H15N3O7S2
and a molecular weight of 413.43 g/mol. Its IUPAC name is [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate.
Molecular Properties
| Compound Name | [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate |
| PubChem CID | 13392821 |
| Molecular Formula | C15H15N3O7S2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate |
| SMILES | COc1cc(OS(C)(=O)=O)ccc1-c1nc2nc(OS(C)(=O)=O)ccc2[nH]1 |
| InChI | InChI=1S/C15H15N3O7S2/c1-23-12-8-9(24-26(2,19)20)4-5-10(12)14-16-11-6-7-13(17-15(11)18-14)25-27(3,21)22/h4-8H,1-3H3,(H,16,17,18) |
| InChIKey | DIYNQBMMBPCCBO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate?
The IUPAC name of [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate (CID 13392821) is [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate.
What is the SMILES notation for [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate?
The canonical SMILES for [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate is COc1cc(OS(C)(=O)=O)ccc1-c1nc2nc(OS(C)(=O)=O)ccc2[nH]1.
What is the InChIKey of [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate?
The InChIKey is DIYNQBMMBPCCBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O7S2/c1-23-12-8-9(24-26(2,19)20)4-5-10(12)14-16-11-6-7-13(17-15(11)18-14)25-27(3,21)22/h4-8H,1-3H3,(H,16,17,18).
What are the key properties of [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate?
[3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate has a molecular weight of 413.43 g/mol, XLogP of 1.31, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methoxy-4-(5-methylsulfonyloxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl] methanesulfonate is sourced from PubChem (CID 13392821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).