C14H13N3O5S — CID 13392826
[3-methoxy-4-(4-oxo-1,5-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate (PubChem CID 13392826) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is [3-methoxy-4-(4-oxo-1,5-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate.
| Compound Name | [3-methoxy-4-(4-oxo-1,5-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 13392826 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | [3-methoxy-4-(4-oxo-1,5-dihydroimidazo[4,5-c]pyridin-2-yl)phenyl] methanesulfonate |
| SMILES | COc1cc(OS(C)(=O)=O)ccc1-c1nc2c(=O)[nH]ccc2[nH]1 |
| InChI | InChI=1S/C14H13N3O5S/c1-21-11-7-8(22-23(2,19)20)3-4-9(11)13-16-10-5-6-15-14(18)12(10)17-13/h3-7H,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | NEZDIWUJEIUCRO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|