C18H26O12 — CID 13393019
[(2S,3R,4R,5S)-2,3,4,5,6-pentaacetyloxyhexyl] acetate (PubChem CID 13393019) has the molecular formula C18H26O12 and a molecular weight of 434.39 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-2,3,4,5,6-pentaacetyloxyhexyl] acetate.
| Compound Name | [(2S,3R,4R,5S)-2,3,4,5,6-pentaacetyloxyhexyl] acetate |
|---|---|
| PubChem CID | 13393019 |
| Molecular Formula | C18H26O12 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | [(2S,3R,4R,5S)-2,3,4,5,6-pentaacetyloxyhexyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H26O12/c1-9(19)25-7-15(27-11(3)21)17(29-13(5)23)18(30-14(6)24)16(28-12(4)22)8-26-10(2)20/h15-18H,7-8H2,1-6H3/t15-,16-,17+,18+/m0/s1 |
| InChIKey | NJVBTKVPPOFGAT-WNRNVDISSA-N |
| XLogP | -0.16 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|