About 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole
2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole (PubChem CID 13393069) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole |
| PubChem CID | 13393069 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole |
| SMILES | CCn1ccnc1C1COc2ccccc2O1 |
| InChI | InChI=1S/C13H14N2O2/c1-2-15-8-7-14-13(15)12-9-16-10-5-3-4-6-11(10)17-12/h3-8,12H,2,9H2,1H3 |
| InChIKey | BLZOWUNQHKBMTA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole?
The IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole (CID 13393069) is 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole.
What is the SMILES notation for 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole?
The canonical SMILES for 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole is CCn1ccnc1C1COc2ccccc2O1.
What is the InChIKey of 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole?
The InChIKey is BLZOWUNQHKBMTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-2-15-8-7-14-13(15)12-9-16-10-5-3-4-6-11(10)17-12/h3-8,12H,2,9H2,1H3.
What are the key properties of 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole?
2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole has a molecular weight of 230.27 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-ethylimidazole is sourced from PubChem (CID 13393069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).