C22H34O4 — CID 13393089
(2E,6E,10E,14E)-16-ethoxy-2,6,10,14-tetramethyl-16-oxohexadeca-2,6,10,14-tetraenoic acid (PubChem CID 13393089) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (2E,6E,10E,14E)-16-ethoxy-2,6,10,14-tetramethyl-16-oxohexadeca-2,6,10,14-tetraenoic acid.
| Compound Name | (2E,6E,10E,14E)-16-ethoxy-2,6,10,14-tetramethyl-16-oxohexadeca-2,6,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 13393089 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (2E,6E,10E,14E)-16-ethoxy-2,6,10,14-tetramethyl-16-oxohexadeca-2,6,10,14-tetraenoic acid |
| SMILES | CCOC(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C22H34O4/c1-6-26-21(23)16-19(4)14-8-12-17(2)10-7-11-18(3)13-9-15-20(5)22(24)25/h11-12,15-16H,6-10,13-14H2,1-5H3,(H,24,25)/b17-12+,18-11+,19-16+,20-15+ |
| InChIKey | GGALKLHVTUIRQF-VNNXFBFOSA-N |
| XLogP | 5.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|