About 6-nitro-1,3-benzothiazole-2-sulfonamide
6-nitro-1,3-benzothiazole-2-sulfonamide (PubChem CID 13393427) has the molecular formula C7H5N3O4S2
and a molecular weight of 259.27 g/mol. Its IUPAC name is 6-nitro-1,3-benzothiazole-2-sulfonamide.
Molecular Properties
| Compound Name | 6-nitro-1,3-benzothiazole-2-sulfonamide |
| PubChem CID | 13393427 |
| Molecular Formula | C7H5N3O4S2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | 6-nitro-1,3-benzothiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C7H5N3O4S2/c8-16(13,14)7-9-5-2-1-4(10(11)12)3-6(5)15-7/h1-3H,(H2,8,13,14) |
| InChIKey | VDPWQQORTOWPSP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-1,3-benzothiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-1,3-benzothiazole-2-sulfonamide?
The IUPAC name of 6-nitro-1,3-benzothiazole-2-sulfonamide (CID 13393427) is 6-nitro-1,3-benzothiazole-2-sulfonamide.
What is the SMILES notation for 6-nitro-1,3-benzothiazole-2-sulfonamide?
The canonical SMILES for 6-nitro-1,3-benzothiazole-2-sulfonamide is NS(=O)(=O)c1nc2ccc([N+](=O)[O-])cc2s1.
What is the InChIKey of 6-nitro-1,3-benzothiazole-2-sulfonamide?
The InChIKey is VDPWQQORTOWPSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O4S2/c8-16(13,14)7-9-5-2-1-4(10(11)12)3-6(5)15-7/h1-3H,(H2,8,13,14).
What are the key properties of 6-nitro-1,3-benzothiazole-2-sulfonamide?
6-nitro-1,3-benzothiazole-2-sulfonamide has a molecular weight of 259.27 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-1,3-benzothiazole-2-sulfonamide is sourced from PubChem (CID 13393427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).