About [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine
[6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine (PubChem CID 13393629) has the molecular formula C9H15N5O2S
and a molecular weight of 257.32 g/mol. Its IUPAC name is [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine |
| PubChem CID | 13393629 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(NN)cc(N2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C9H15N5O2S/c1-7-11-8(13-10)6-9(12-7)14-2-4-17(15,16)5-3-14/h6H,2-5,10H2,1H3,(H,11,12,13) |
| InChIKey | NMSMVXKNXFCMLO-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine?
The IUPAC name of [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine (CID 13393629) is [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine.
What is the SMILES notation for [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine?
The canonical SMILES for [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine is Cc1nc(NN)cc(N2CCS(=O)(=O)CC2)n1.
What is the InChIKey of [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine?
The InChIKey is NMSMVXKNXFCMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2S/c1-7-11-8(13-10)6-9(12-7)14-2-4-17(15,16)5-3-14/h6H,2-5,10H2,1H3,(H,11,12,13).
What are the key properties of [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine?
[6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine has a molecular weight of 257.32 g/mol, XLogP of -0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpyrimidin-4-yl]hydrazine is sourced from PubChem (CID 13393629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).