About 5,7-dimethoxyimidazo[1,2-c]pyrimidine
5,7-dimethoxyimidazo[1,2-c]pyrimidine (PubChem CID 13394199) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is 5,7-dimethoxyimidazo[1,2-c]pyrimidine.
Molecular Properties
| Compound Name | 5,7-dimethoxyimidazo[1,2-c]pyrimidine |
| PubChem CID | 13394199 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5,7-dimethoxyimidazo[1,2-c]pyrimidine |
| SMILES | COc1cc2nccn2c(OC)n1 |
| InChI | InChI=1S/C8H9N3O2/c1-12-7-5-6-9-3-4-11(6)8(10-7)13-2/h3-5H,1-2H3 |
| InChIKey | XPWFMIFPXPFSBU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,7-dimethoxyimidazo[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethoxyimidazo[1,2-c]pyrimidine?
The IUPAC name of 5,7-dimethoxyimidazo[1,2-c]pyrimidine (CID 13394199) is 5,7-dimethoxyimidazo[1,2-c]pyrimidine.
What is the SMILES notation for 5,7-dimethoxyimidazo[1,2-c]pyrimidine?
The canonical SMILES for 5,7-dimethoxyimidazo[1,2-c]pyrimidine is COc1cc2nccn2c(OC)n1.
What is the InChIKey of 5,7-dimethoxyimidazo[1,2-c]pyrimidine?
The InChIKey is XPWFMIFPXPFSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-12-7-5-6-9-3-4-11(6)8(10-7)13-2/h3-5H,1-2H3.
What are the key properties of 5,7-dimethoxyimidazo[1,2-c]pyrimidine?
5,7-dimethoxyimidazo[1,2-c]pyrimidine has a molecular weight of 179.18 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethoxyimidazo[1,2-c]pyrimidine is sourced from PubChem (CID 13394199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).