About N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride
N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride (PubChem CID 13394202) has the molecular formula C8H11ClN4S
and a molecular weight of 230.72 g/mol. Its IUPAC name is N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride |
| PubChem CID | 13394202 |
| Molecular Formula | C8H11ClN4S |
| Molecular Weight | 230.72 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride |
| SMILES | CNc1cc2nccn2c(SC)n1.Cl |
| InChI | InChI=1S/C8H10N4S.ClH/c1-9-6-5-7-10-3-4-12(7)8(11-6)13-2;/h3-5,9H,1-2H3;1H |
| InChIKey | DNMMDIVSXPFAMT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.72 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride?
The IUPAC name of N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride (CID 13394202) is N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride.
What is the SMILES notation for N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride?
The canonical SMILES for N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride is CNc1cc2nccn2c(SC)n1.Cl.
What is the InChIKey of N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride?
The InChIKey is DNMMDIVSXPFAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S.ClH/c1-9-6-5-7-10-3-4-12(7)8(11-6)13-2;/h3-5,9H,1-2H3;1H.
What are the key properties of N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride?
N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride has a molecular weight of 230.72 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-5-methylsulfanylimidazo[1,2-c]pyrimidin-7-amine;hydrochloride is sourced from PubChem (CID 13394202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).