About 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one
4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one (PubChem CID 13394850) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one.
Molecular Properties
| Compound Name | 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one |
| PubChem CID | 13394850 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one |
| SMILES | CN1C(=O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C11H17NO/c1-12-10-5-7-2-8(6-10)4-9(3-7)11(12)13/h7-10H,2-6H2,1H3 |
| InChIKey | NGOMHSBTLDUYGH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one?
The IUPAC name of 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one (CID 13394850) is 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one.
What is the SMILES notation for 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one?
The canonical SMILES for 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one is CN1C(=O)C2CC3CC(C2)CC1C3.
What is the InChIKey of 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one?
The InChIKey is NGOMHSBTLDUYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-12-10-5-7-2-8(6-10)4-9(3-7)11(12)13/h7-10H,2-6H2,1H3.
What are the key properties of 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one?
4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one has a molecular weight of 179.26 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-azatricyclo[4.3.1.13,8]undecan-5-one is sourced from PubChem (CID 13394850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).