About 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene
2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 13395058) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene.
Molecular Properties
| Compound Name | 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene |
| PubChem CID | 13395058 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | COCC1=CC2C=CC1C2 |
| InChI | InChI=1S/C9H12O/c1-10-6-9-5-7-2-3-8(9)4-7/h2-3,5,7-8H,4,6H2,1H3 |
| InChIKey | ZJVYIAAXLJQWRN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene?
The IUPAC name of 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene (CID 13395058) is 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene.
What is the SMILES notation for 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene?
The canonical SMILES for 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene is COCC1=CC2C=CC1C2.
What is the InChIKey of 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene?
The InChIKey is ZJVYIAAXLJQWRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-10-6-9-5-7-2-3-8(9)4-7/h2-3,5,7-8H,4,6H2,1H3.
What are the key properties of 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene?
2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene has a molecular weight of 136.19 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)bicyclo[2.2.1]hepta-2,5-diene is sourced from PubChem (CID 13395058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).