C11H6F12 — CID 13395536
5,5,6,6-tetrakis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 13395536) has the molecular formula C11H6F12 and a molecular weight of 366.15 g/mol. Its IUPAC name is 5,5,6,6-tetrakis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,5,6,6-tetrakis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 13395536 |
| Molecular Formula | C11H6F12 |
| Molecular Weight | 366.15 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 5,5,6,6-tetrakis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1(C(F)(F)F)C2C=CC(C2)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6F12/c12-8(13,14)6(9(15,16)17)4-1-2-5(3-4)7(6,10(18,19)20)11(21,22)23/h1-2,4-5H,3H2 |
| InChIKey | DCSRANNUZMQMBI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.15 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|