C11H8F12O — CID 13395542
5,5,6,6-tetrakis(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 13395542) has the molecular formula C11H8F12O and a molecular weight of 384.16 g/mol. Its IUPAC name is 5,5,6,6-tetrakis(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | 5,5,6,6-tetrakis(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 13395542 |
| Molecular Formula | C11H8F12O |
| Molecular Weight | 384.16 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 5,5,6,6-tetrakis(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | OC1CC2CC1C(C(F)(F)F)(C(F)(F)F)C2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F12O/c12-8(13,14)6(9(15,16)17)3-1-4(5(24)2-3)7(6,10(18,19)20)11(21,22)23/h3-5,24H,1-2H2 |
| InChIKey | WVKQVQMKZNIYEA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.16 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |