C22H34O5Si — CID 13396913
methyl 3'-[tert-butyl(dimethyl)silyl]oxy-3'a-prop-2-enylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-indene]-1'-carboxylate (PubChem CID 13396913) has the molecular formula C22H34O5Si and a molecular weight of 406.60 g/mol. Its IUPAC name is methyl 3'-[tert-butyl(dimethyl)silyl]oxy-3'a-prop-2-enylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-indene]-1'-carboxylate.
| Compound Name | methyl 3'-[tert-butyl(dimethyl)silyl]oxy-3'a-prop-2-enylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-indene]-1'-carboxylate |
|---|---|
| PubChem CID | 13396913 |
| Molecular Formula | C22H34O5Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | methyl 3'-[tert-butyl(dimethyl)silyl]oxy-3'a-prop-2-enylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-indene]-1'-carboxylate |
| SMILES | C=CCC12CC3(CCC1=C(C(=O)OC)C=C2O[Si](C)(C)C(C)(C)C)OCCO3 |
| InChI | InChI=1S/C22H34O5Si/c1-8-10-21-15-22(25-12-13-26-22)11-9-17(21)16(19(23)24-5)14-18(21)27-28(6,7)20(2,3)4/h8,14H,1,9-13,15H2,2-7H3 |
| InChIKey | KDZBAKREVORIAS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|