About 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine
4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine (PubChem CID 13396949) has the molecular formula C18H15N3
and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine.
Molecular Properties
| Compound Name | 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine |
| PubChem CID | 13396949 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c2c(n1)-c1ccccc1CC2 |
| InChI | InChI=1S/C18H15N3/c19-18-20-16(13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)17(15)21-18/h1-9H,10-11H2,(H2,19,20,21) |
| InChIKey | FDHYRRFKEAUQLP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine?
The IUPAC name of 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine (CID 13396949) is 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine.
What is the SMILES notation for 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine?
The canonical SMILES for 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine is Nc1nc(-c2ccccc2)c2c(n1)-c1ccccc1CC2.
What is the InChIKey of 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine?
The InChIKey is FDHYRRFKEAUQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3/c19-18-20-16(13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)17(15)21-18/h1-9H,10-11H2,(H2,19,20,21).
What are the key properties of 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine?
4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine has a molecular weight of 273.34 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-5,6-dihydrobenzo[h]quinazolin-2-amine is sourced from PubChem (CID 13396949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).