About (4-chlorophenyl)methanol
(4-chlorophenyl)methanol (PubChem CID 13397) has the molecular formula C7H7ClO
and a molecular weight of 142.58 g/mol. Its IUPAC name is (4-chlorophenyl)methanol.
Molecular Properties
| Compound Name | (4-chlorophenyl)methanol |
| PubChem CID | 13397 |
| Molecular Formula | C7H7ClO |
| Molecular Weight | 142.58 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | (4-chlorophenyl)methanol |
| SMILES | OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H7ClO/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5H2 |
| InChIKey | PTHGDVCPCZKZKR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.58 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-chlorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methanol?
The IUPAC name of (4-chlorophenyl)methanol (CID 13397) is (4-chlorophenyl)methanol.
What is the SMILES notation for (4-chlorophenyl)methanol?
The canonical SMILES for (4-chlorophenyl)methanol is OCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methanol?
The InChIKey is PTHGDVCPCZKZKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5H2.
What are the key properties of (4-chlorophenyl)methanol?
(4-chlorophenyl)methanol has a molecular weight of 142.58 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methanol is sourced from PubChem (CID 13397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).