C15H19NO3 — CID 13397309
(4S,5S)-4-(methoxymethyl)-5-phenyl-2-(prop-2-enoxymethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 13397309) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (4S,5S)-4-(methoxymethyl)-5-phenyl-2-(prop-2-enoxymethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-4-(methoxymethyl)-5-phenyl-2-(prop-2-enoxymethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 13397309 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (4S,5S)-4-(methoxymethyl)-5-phenyl-2-(prop-2-enoxymethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | C=CCOCC1=N[C@@H](COC)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C15H19NO3/c1-3-9-18-11-14-16-13(10-17-2)15(19-14)12-7-5-4-6-8-12/h3-8,13,15H,1,9-11H2,2H3/t13-,15-/m0/s1 |
| InChIKey | IYHQMJZYFZXPJO-ZFWWWQNUSA-N |
| XLogP | 2.37 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|