About propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate
propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate (PubChem CID 13397496) has the molecular formula C12H13NO6
and a molecular weight of 267.24 g/mol. Its IUPAC name is propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate.
Molecular Properties
| Compound Name | propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate |
| PubChem CID | 13397496 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate |
| SMILES | CC(C)OC(=O)OC(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H13NO6/c1-8(2)18-12(15)19-11(14)7-9-3-5-10(6-4-9)13(16)17/h3-6,8H,7H2,1-2H3 |
| InChIKey | POWQYJZZGKHLRD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate?
The IUPAC name of propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate (CID 13397496) is propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate.
What is the SMILES notation for propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate?
The canonical SMILES for propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate is CC(C)OC(=O)OC(=O)Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate?
The InChIKey is POWQYJZZGKHLRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO6/c1-8(2)18-12(15)19-11(14)7-9-3-5-10(6-4-9)13(16)17/h3-6,8H,7H2,1-2H3.
What are the key properties of propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate?
propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate has a molecular weight of 267.24 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yloxycarbonyl 2-(4-nitrophenyl)acetate is sourced from PubChem (CID 13397496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).