C32H48Cl2N6O2 — CID 13397723
3-(benzylamino)-1-[12-[3-(benzylamino)propanoyl]-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecan-3-yl]propan-1-one dichloride (PubChem CID 13397723) has the molecular formula C32H48Cl2N6O2 and a molecular weight of 619.68 g/mol. Its IUPAC name is 3-(benzylamino)-1-[12-[3-(benzylamino)propanoyl]-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecan-3-yl]propan-1-one dichloride.
| Compound Name | 3-(benzylamino)-1-[12-[3-(benzylamino)propanoyl]-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecan-3-yl]propan-1-one dichloride |
|---|---|
| PubChem CID | 13397723 |
| Molecular Formula | C32H48Cl2N6O2 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 3-(benzylamino)-1-[12-[3-(benzylamino)propanoyl]-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecan-3-yl]propan-1-one dichloride |
| SMILES | O=C(CCNCc1ccccc1)N1CC[N+]2(CC1)CC[N+]1(CCN(C(=O)CCNCc3ccccc3)CC1)CC2.[Cl-].[Cl-] |
| InChI | InChI=1S/C32H48N6O2.2ClH/c39-31(11-13-33-27-29-7-3-1-4-8-29)35-15-19-37(20-16-35)23-25-38(26-24-37)21-17-36(18-22-38)32(40)12-14-34-28-30-9-5-2-6-10-30;;/h1-10,33-34H,11-28H2;2*1H/q+2;;/p-2 |
| InChIKey | LWIFNJYKWWTECW-UHFFFAOYSA-L |
| XLogP | -4.31 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | -4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|