C9H11N3O3 — CID 13398269
1-(1-hydroxybutan-2-yl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 13398269) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 1-(1-hydroxybutan-2-yl)-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-(1-hydroxybutan-2-yl)-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 13398269 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 1-(1-hydroxybutan-2-yl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CCC(CO)n1cc(C#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H11N3O3/c1-2-7(5-13)12-4-6(3-10)8(14)11-9(12)15/h4,7,13H,2,5H2,1H3,(H,11,14,15) |
| InChIKey | JXFDFBSGGCESDU-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |