C22H19FN2O3 — CID 134000496
N-[4-[[[2-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 134000496) has the molecular formula C22H19FN2O3 and a molecular weight of 378.40 g/mol. Its IUPAC name is N-[4-[[[2-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[2-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134000496 |
| Molecular Formula | C22H19FN2O3 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[4-[[[2-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(CNC(=O)C2CC2c2ccccc2F)cc1)c1ccco1 |
| InChI | InChI=1S/C22H19FN2O3/c23-19-5-2-1-4-16(19)17-12-18(17)21(26)24-13-14-7-9-15(10-8-14)25-22(27)20-6-3-11-28-20/h1-11,17-18H,12-13H2,(H,24,26)(H,25,27) |
| InChIKey | DSXVEUUFQXGYDB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |