C19H20FNOS — CID 134002240
1-(4-fluorophenyl)-N-methyl-N-[(4-methylsulfanylphenyl)methyl]cyclopropane-1-carboxamide (PubChem CID 134002240) has the molecular formula C19H20FNOS and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-methyl-N-[(4-methylsulfanylphenyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-methyl-N-[(4-methylsulfanylphenyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134002240 |
| Molecular Formula | C19H20FNOS |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-(4-fluorophenyl)-N-methyl-N-[(4-methylsulfanylphenyl)methyl]cyclopropane-1-carboxamide |
| SMILES | CSc1ccc(CN(C)C(=O)C2(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H20FNOS/c1-21(13-14-3-9-17(23-2)10-4-14)18(22)19(11-12-19)15-5-7-16(20)8-6-15/h3-10H,11-13H2,1-2H3 |
| InChIKey | AGPYRMZEQOIGQV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |