C15H18N2O4S2 — CID 134002358
8-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)quinoline-5-sulfonamide (PubChem CID 134002358) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 8-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)quinoline-5-sulfonamide.
| Compound Name | 8-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 134002358 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 8-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)quinoline-5-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2(C)CCS(=O)(=O)C2)c2cccnc12 |
| InChI | InChI=1S/C15H18N2O4S2/c1-11-5-6-13(12-4-3-8-16-14(11)12)23(20,21)17-15(2)7-9-22(18,19)10-15/h3-6,8,17H,7,9-10H2,1-2H3 |
| InChIKey | GZSBGPPNOQRWCI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |