C20H15FN4O — CID 134004771
N-[6-(benzimidazol-1-yl)-3-pyridinyl]-2-(2-fluorophenyl)acetamide (PubChem CID 134004771) has the molecular formula C20H15FN4O and a molecular weight of 346.37 g/mol. Its IUPAC name is N-[6-(benzimidazol-1-yl)-3-pyridinyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[6-(benzimidazol-1-yl)-3-pyridinyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 134004771 |
| Molecular Formula | C20H15FN4O |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[6-(benzimidazol-1-yl)-3-pyridinyl]-2-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1F)Nc1ccc(-n2cnc3ccccc32)nc1 |
| InChI | InChI=1S/C20H15FN4O/c21-16-6-2-1-5-14(16)11-20(26)24-15-9-10-19(22-12-15)25-13-23-17-7-3-4-8-18(17)25/h1-10,12-13H,11H2,(H,24,26) |
| InChIKey | BMWUJGSEGFYVOR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |