About 4-methyl-2,6-dipropylpyridine
4-methyl-2,6-dipropylpyridine (PubChem CID 13400495) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 4-methyl-2,6-dipropylpyridine.
Molecular Properties
| Compound Name | 4-methyl-2,6-dipropylpyridine |
| PubChem CID | 13400495 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 4-methyl-2,6-dipropylpyridine |
| SMILES | CCCc1cc(C)cc(CCC)n1 |
| InChI | InChI=1S/C12H19N/c1-4-6-11-8-10(3)9-12(13-11)7-5-2/h8-9H,4-7H2,1-3H3 |
| InChIKey | OARMLPMRBILYCE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-2,6-dipropylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,6-dipropylpyridine?
The IUPAC name of 4-methyl-2,6-dipropylpyridine (CID 13400495) is 4-methyl-2,6-dipropylpyridine.
What is the SMILES notation for 4-methyl-2,6-dipropylpyridine?
The canonical SMILES for 4-methyl-2,6-dipropylpyridine is CCCc1cc(C)cc(CCC)n1.
What is the InChIKey of 4-methyl-2,6-dipropylpyridine?
The InChIKey is OARMLPMRBILYCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-4-6-11-8-10(3)9-12(13-11)7-5-2/h8-9H,4-7H2,1-3H3.
What are the key properties of 4-methyl-2,6-dipropylpyridine?
4-methyl-2,6-dipropylpyridine has a molecular weight of 177.29 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,6-dipropylpyridine is sourced from PubChem (CID 13400495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).