C19H23N3O3S — CID 134006882
4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propylsulfamoyl]benzamide (PubChem CID 134006882) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propylsulfamoyl]benzamide.
| Compound Name | 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 134006882 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propylsulfamoyl]benzamide |
| SMILES | CC(CNS(=O)(=O)c1ccc(C(N)=O)cc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H23N3O3S/c1-14(22-11-10-15-4-2-3-5-17(15)13-22)12-21-26(24,25)18-8-6-16(7-9-18)19(20)23/h2-9,14,21H,10-13H2,1H3,(H2,20,23) |
| InChIKey | SIDILNXBFKCMNS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |